C44H43N3O10 — CID 135553630
ethyl 2-[4-[4,6-bis[4-(1-ethoxy-1-oxopropan-2-yl)oxynaphthalen-1-yl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate (PubChem CID 135553630) has the molecular formula C44H43N3O10 and a molecular weight of 773.84 g/mol. Its IUPAC name is ethyl 2-[4-[4,6-bis[4-(1-ethoxy-1-oxopropan-2-yl)oxynaphthalen-1-yl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate.
| Compound Name | ethyl 2-[4-[4,6-bis[4-(1-ethoxy-1-oxopropan-2-yl)oxynaphthalen-1-yl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
|---|---|
| PubChem CID | 135553630 |
| Molecular Formula | C44H43N3O10 |
| Molecular Weight | 773.84 g/mol |
| Exact Mass | 773.29 |
| IUPAC Name | ethyl 2-[4-[4,6-bis[4-(1-ethoxy-1-oxopropan-2-yl)oxynaphthalen-1-yl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1ccc(-c2nc(-c3ccc(OC(C)C(=O)OCC)c4ccccc34)nc(-c3ccc(OC(C)C(=O)OCC)c4ccccc34)n2)c(O)c1 |
| InChI | InChI=1S/C44H43N3O10/c1-7-52-42(49)25(4)55-28-18-19-35(36(48)24-28)41-46-39(33-20-22-37(31-16-12-10-14-29(31)33)56-26(5)43(50)53-8-2)45-40(47-41)34-21-23-38(32-17-13-11-15-30(32)34)57-27(6)44(51)54-9-3/h10-27,48H,7-9H2,1-6H3 |
| InChIKey | XKKIFNMZMQQTML-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 165.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.84 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|