C36H43N3O4 — CID 163385500
octyl 2-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate (PubChem CID 163385500) has the molecular formula C36H43N3O4 and a molecular weight of 581.76 g/mol. Its IUPAC name is octyl 2-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate.
| Compound Name | octyl 2-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
|---|---|
| PubChem CID | 163385500 |
| Molecular Formula | C36H43N3O4 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | octyl 2-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
| SMILES | CCCCCCCCOC(=O)C(C)Oc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1 |
| InChI | InChI=1S/C36H43N3O4/c1-7-8-9-10-11-12-19-42-36(41)27(6)43-28-15-18-31(32(40)22-28)35-38-33(29-16-13-23(2)20-25(29)4)37-34(39-35)30-17-14-24(3)21-26(30)5/h13-18,20-22,27,40H,7-12,19H2,1-6H3 |
| InChIKey | IWSXSJCNIXOKLJ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|