C59H83N3O13 — CID 137253439
methyl 2-[4-[4-[2,4-bis[(1-octoxy-1-oxopropan-2-yl)oxy]phenyl]-6-[2-hydroxy-4-(3-oxododecan-2-yloxy)phenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate (PubChem CID 137253439) has the molecular formula C59H83N3O13 and a molecular weight of 1042.32 g/mol. Its IUPAC name is methyl 2-[4-[4-[2,4-bis[(1-octoxy-1-oxopropan-2-yl)oxy]phenyl]-6-[2-hydroxy-4-(3-oxododecan-2-yloxy)phenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate.
| Compound Name | methyl 2-[4-[4-[2,4-bis[(1-octoxy-1-oxopropan-2-yl)oxy]phenyl]-6-[2-hydroxy-4-(3-oxododecan-2-yloxy)phenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
|---|---|
| PubChem CID | 137253439 |
| Molecular Formula | C59H83N3O13 |
| Molecular Weight | 1042.32 g/mol |
| Exact Mass | 1041.59 |
| IUPAC Name | methyl 2-[4-[4-[2,4-bis[(1-octoxy-1-oxopropan-2-yl)oxy]phenyl]-6-[2-hydroxy-4-(3-oxododecan-2-yloxy)phenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
| SMILES | CCCCCCCCCC(=O)C(C)Oc1ccc(-c2nc(-c3ccc(OC(C)C(=O)OC)cc3O)nc(-c3ccc(OC(C)C(=O)OCCCCCCCC)cc3OC(C)C(=O)OCCCCCCCC)n2)c(O)c1 |
| InChI | InChI=1S/C59H83N3O13/c1-9-12-15-18-21-22-25-28-50(63)40(4)72-44-29-32-47(51(64)37-44)54-60-55(48-33-30-45(38-52(48)65)73-41(5)57(66)69-8)62-56(61-54)49-34-31-46(74-42(6)58(67)70-35-26-23-19-16-13-10-2)39-53(49)75-43(7)59(68)71-36-27-24-20-17-14-11-3/h29-34,37-43,64-65H,9-28,35-36H2,1-8H3 |
| InChIKey | VXSBEYFFUVEFJA-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 212.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.32 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|