C34H33N3O12 — CID 135967659
2-[3-hydroxy-4-[4-[2-hydroxy-4-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]phenoxy]propanoyloxymethyl 3-oxobutanoate (PubChem CID 135967659) has the molecular formula C34H33N3O12 and a molecular weight of 675.65 g/mol. Its IUPAC name is 2-[3-hydroxy-4-[4-[2-hydroxy-4-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]phenoxy]propanoyloxymethyl 3-oxobutanoate.
| Compound Name | 2-[3-hydroxy-4-[4-[2-hydroxy-4-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]phenoxy]propanoyloxymethyl 3-oxobutanoate |
|---|---|
| PubChem CID | 135967659 |
| Molecular Formula | C34H33N3O12 |
| Molecular Weight | 675.65 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | 2-[3-hydroxy-4-[4-[2-hydroxy-4-(1-methoxy-1-oxopropan-2-yl)oxyphenyl]-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]phenoxy]propanoyloxymethyl 3-oxobutanoate |
| SMILES | COC(=O)C(C)Oc1ccc(-c2nc(-c3ccc(OC)cc3)nc(-c3ccc(OC(C)C(=O)OCOC(=O)CC(C)=O)cc3O)n2)c(O)c1 |
| InChI | InChI=1S/C34H33N3O12/c1-18(38)14-29(41)46-17-47-34(43)20(3)49-24-11-13-26(28(40)16-24)32-36-30(21-6-8-22(44-4)9-7-21)35-31(37-32)25-12-10-23(15-27(25)39)48-19(2)33(42)45-5/h6-13,15-16,19-20,39-40H,14,17H2,1-5H3 |
| InChIKey | AAYOSSUEHMUOGT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 202.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|