C38H31N3O3 — CID 165088688
2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]pentan-3-one (PubChem CID 165088688) has the molecular formula C38H31N3O3 and a molecular weight of 577.68 g/mol. Its IUPAC name is 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]pentan-3-one.
| Compound Name | 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]pentan-3-one |
|---|---|
| PubChem CID | 165088688 |
| Molecular Formula | C38H31N3O3 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]pentan-3-one |
| SMILES | CCC(=O)C(C)Oc1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C38H31N3O3/c1-3-34(42)25(2)44-32-22-23-33(35(43)24-32)38-40-36(30-18-14-28(15-19-30)26-10-6-4-7-11-26)39-37(41-38)31-20-16-29(17-21-31)27-12-8-5-9-13-27/h4-25,43H,3H2,1-2H3 |
| InChIKey | WIHZTTJETSHNJY-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |