C43H49N3O4Si3 — CID 136622044
2-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-5-[2-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenol (PubChem CID 136622044) has the molecular formula C43H49N3O4Si3 and a molecular weight of 756.14 g/mol. Its IUPAC name is 2-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-5-[2-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenol.
| Compound Name | 2-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-5-[2-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenol |
|---|---|
| PubChem CID | 136622044 |
| Molecular Formula | C43H49N3O4Si3 |
| Molecular Weight | 756.14 g/mol |
| Exact Mass | 755.30 |
| IUPAC Name | 2-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-5-[2-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenol |
| SMILES | CC(COc1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c(O)c1)[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C43H49N3O4Si3/c1-31(53(8,49-51(2,3)4)50-52(5,6)7)30-48-38-27-28-39(40(47)29-38)43-45-41(36-23-19-34(20-24-36)32-15-11-9-12-16-32)44-42(46-43)37-25-21-35(22-26-37)33-17-13-10-14-18-33/h9-29,31,47H,30H2,1-8H3 |
| InChIKey | SGEHHLWFMREBSQ-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.14 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|