C31H31N3O4 — CID 137304972
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[6-(4-hydroxybut-3-yn-2-yloxy)hexoxy]phenol (PubChem CID 137304972) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[6-(4-hydroxybut-3-yn-2-yloxy)hexoxy]phenol.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[6-(4-hydroxybut-3-yn-2-yloxy)hexoxy]phenol |
|---|---|
| PubChem CID | 137304972 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[6-(4-hydroxybut-3-yn-2-yloxy)hexoxy]phenol |
| SMILES | CC(C#CO)OCCCCCCOc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(O)c1 |
| InChI | InChI=1S/C31H31N3O4/c1-23(18-19-35)37-20-10-2-3-11-21-38-26-16-17-27(28(36)22-26)31-33-29(24-12-6-4-7-13-24)32-30(34-31)25-14-8-5-9-15-25/h4-9,12-17,22-23,35-36H,2-3,10-11,20-21H2,1H3 |
| InChIKey | JLQWLZDVNWGXBQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|