C29H29N3O3 — CID 18676250
[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenyl] acetate (PubChem CID 18676250) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is [2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenyl] acetate.
| Compound Name | [2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenyl] acetate |
|---|---|
| PubChem CID | 18676250 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | [2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenyl] acetate |
| SMILES | CCCCCCOc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(OC(C)=O)c1 |
| InChI | InChI=1S/C29H29N3O3/c1-3-4-5-12-19-34-24-17-18-25(26(20-24)35-21(2)33)29-31-27(22-13-8-6-9-14-22)30-28(32-29)23-15-10-7-11-16-23/h6-11,13-18,20H,3-5,12,19H2,1-2H3 |
| InChIKey | XIQNAAYOWQOMQA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|