C39H49N3O3 — CID 18676242
[2-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenyl] acetate (PubChem CID 18676242) has the molecular formula C39H49N3O3 and a molecular weight of 607.84 g/mol. Its IUPAC name is [2-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenyl] acetate.
| Compound Name | [2-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenyl] acetate |
|---|---|
| PubChem CID | 18676242 |
| Molecular Formula | C39H49N3O3 |
| Molecular Weight | 607.84 g/mol |
| Exact Mass | 607.38 |
| IUPAC Name | [2-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenyl] acetate |
| SMILES | CCCCCCCCOc1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)c(OC(C)=O)c1 |
| InChI | InChI=1S/C39H49N3O3/c1-9-10-11-12-13-14-25-44-32-23-24-33(34(26-32)45-27(2)43)37-41-35(28-15-19-30(20-16-28)38(3,4)5)40-36(42-37)29-17-21-31(22-18-29)39(6,7)8/h15-24,26H,9-14,25H2,1-8H3 |
| InChIKey | DHWYCNQBVCDSEZ-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.84 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|