C39H49N3O4 — CID 135740038
ethyl 2-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-2-hexyl-5-hydroxyphenoxy]acetate (PubChem CID 135740038) has the molecular formula C39H49N3O4 and a molecular weight of 623.84 g/mol. Its IUPAC name is ethyl 2-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-2-hexyl-5-hydroxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-2-hexyl-5-hydroxyphenoxy]acetate |
|---|---|
| PubChem CID | 135740038 |
| Molecular Formula | C39H49N3O4 |
| Molecular Weight | 623.84 g/mol |
| Exact Mass | 623.37 |
| IUPAC Name | ethyl 2-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-2-hexyl-5-hydroxyphenoxy]acetate |
| SMILES | CCCCCCc1cc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)c(O)cc1OCC(=O)OCC |
| InChI | InChI=1S/C39H49N3O4/c1-9-11-12-13-14-28-23-31(32(43)24-33(28)46-25-34(44)45-10-2)37-41-35(26-15-19-29(20-16-26)38(3,4)5)40-36(42-37)27-17-21-30(22-18-27)39(6,7)8/h15-24,43H,9-14,25H2,1-8H3 |
| InChIKey | BLBFUFYQFAIIQR-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.84 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|