C25H34O4 — CID 155549053
ethyl 2-[4-[4-(4-hydroxy-3-methylphenyl)heptan-4-yl]-2-methylphenoxy]acetate (PubChem CID 155549053) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is ethyl 2-[4-[4-(4-hydroxy-3-methylphenyl)heptan-4-yl]-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[4-(4-hydroxy-3-methylphenyl)heptan-4-yl]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 155549053 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | ethyl 2-[4-[4-(4-hydroxy-3-methylphenyl)heptan-4-yl]-2-methylphenoxy]acetate |
| SMILES | CCCC(CCC)(c1ccc(O)c(C)c1)c1ccc(OCC(=O)OCC)c(C)c1 |
| InChI | InChI=1S/C25H34O4/c1-6-13-25(14-7-2,20-9-11-22(26)18(4)15-20)21-10-12-23(19(5)16-21)29-17-24(27)28-8-3/h9-12,15-16,26H,6-8,13-14,17H2,1-5H3 |
| InChIKey | QWIULWGNMUBABR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |