C23H34O2 — CID 142882643
ethane;4-[4-(4-hydroxy-3-methylphenyl)heptan-4-yl]-2-methylphenol (PubChem CID 142882643) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is ethane;4-[4-(4-hydroxy-3-methylphenyl)heptan-4-yl]-2-methylphenol.
| Compound Name | ethane;4-[4-(4-hydroxy-3-methylphenyl)heptan-4-yl]-2-methylphenol |
|---|---|
| PubChem CID | 142882643 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | ethane;4-[4-(4-hydroxy-3-methylphenyl)heptan-4-yl]-2-methylphenol |
| SMILES | CC.CCCC(CCC)(c1ccc(O)c(C)c1)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C21H28O2.C2H6/c1-5-11-21(12-6-2,17-7-9-19(22)15(3)13-17)18-8-10-20(23)16(4)14-18;1-2/h7-10,13-14,22-23H,5-6,11-12H2,1-4H3;1-2H3 |
| InChIKey | QAFPVGUUCXWKBW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |