C26H30O3 — CID 139775367
4-[1,1-bis(4-hydroxy-3-methylphenyl)pentyl]-2-methylphenol (PubChem CID 139775367) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is 4-[1,1-bis(4-hydroxy-3-methylphenyl)pentyl]-2-methylphenol.
| Compound Name | 4-[1,1-bis(4-hydroxy-3-methylphenyl)pentyl]-2-methylphenol |
|---|---|
| PubChem CID | 139775367 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-[1,1-bis(4-hydroxy-3-methylphenyl)pentyl]-2-methylphenol |
| SMILES | CCCCC(c1ccc(O)c(C)c1)(c1ccc(O)c(C)c1)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C26H30O3/c1-5-6-13-26(20-7-10-23(27)17(2)14-20,21-8-11-24(28)18(3)15-21)22-9-12-25(29)19(4)16-22/h7-12,14-16,27-29H,5-6,13H2,1-4H3 |
| InChIKey | OEASFPLYXRQXOA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|