C37H36O2 — CID 57009241
4-[1-(4-hydroxy-3-phenylphenyl)-1-(4-methylphenyl)hexyl]-2-phenylphenol (PubChem CID 57009241) has the molecular formula C37H36O2 and a molecular weight of 512.69 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-3-phenylphenyl)-1-(4-methylphenyl)hexyl]-2-phenylphenol.
| Compound Name | 4-[1-(4-hydroxy-3-phenylphenyl)-1-(4-methylphenyl)hexyl]-2-phenylphenol |
|---|---|
| PubChem CID | 57009241 |
| Molecular Formula | C37H36O2 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 4-[1-(4-hydroxy-3-phenylphenyl)-1-(4-methylphenyl)hexyl]-2-phenylphenol |
| SMILES | CCCCCC(c1ccc(C)cc1)(c1ccc(O)c(-c2ccccc2)c1)c1ccc(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C37H36O2/c1-3-4-11-24-37(30-18-16-27(2)17-19-30,31-20-22-35(38)33(25-31)28-12-7-5-8-13-28)32-21-23-36(39)34(26-32)29-14-9-6-10-15-29/h5-10,12-23,25-26,38-39H,3-4,11,24H2,1-2H3 |
| InChIKey | NYGVZQODMCCFIC-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|