C21H20O2 — CID 19824837
4-[2-(4-hydroxyphenyl)propan-2-yl]-2-phenylphenol (PubChem CID 19824837) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)propan-2-yl]-2-phenylphenol.
| Compound Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]-2-phenylphenol |
|---|---|
| PubChem CID | 19824837 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]-2-phenylphenol |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H20O2/c1-21(2,16-8-11-18(22)12-9-16)17-10-13-20(23)19(14-17)15-6-4-3-5-7-15/h3-14,22-23H,1-2H3 |
| InChIKey | VWVWXVVCGRAFOC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |