C38H40O2 — CID 67934241
4-[1-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-1-(4-hydroxy-3-phenylphenyl)hexyl]-2-phenylphenol (PubChem CID 67934241) has the molecular formula C38H40O2 and a molecular weight of 528.74 g/mol. Its IUPAC name is 4-[1-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-1-(4-hydroxy-3-phenylphenyl)hexyl]-2-phenylphenol.
| Compound Name | 4-[1-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-1-(4-hydroxy-3-phenylphenyl)hexyl]-2-phenylphenol |
|---|---|
| PubChem CID | 67934241 |
| Molecular Formula | C38H40O2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 4-[1-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-1-(4-hydroxy-3-phenylphenyl)hexyl]-2-phenylphenol |
| SMILES | CCCCCC(c1ccc(O)c(-c2ccccc2)c1)(c1ccc(O)c(-c2ccccc2)c1)C1C=CC=CC1(C)C |
| InChI | InChI=1S/C38H40O2/c1-4-5-13-25-38(36-19-12-14-24-37(36,2)3,30-20-22-34(39)32(26-30)28-15-8-6-9-16-28)31-21-23-35(40)33(27-31)29-17-10-7-11-18-29/h6-12,14-24,26-27,36,39-40H,4-5,13,25H2,1-3H3 |
| InChIKey | IHJGJMSCAZALMK-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|