C30H38O3 — CID 139775343
4-[1,1-bis(4-hydroxy-3,5-dimethylphenyl)hexyl]-2,6-dimethylphenol (PubChem CID 139775343) has the molecular formula C30H38O3 and a molecular weight of 446.63 g/mol. Its IUPAC name is 4-[1,1-bis(4-hydroxy-3,5-dimethylphenyl)hexyl]-2,6-dimethylphenol.
| Compound Name | 4-[1,1-bis(4-hydroxy-3,5-dimethylphenyl)hexyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 139775343 |
| Molecular Formula | C30H38O3 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 4-[1,1-bis(4-hydroxy-3,5-dimethylphenyl)hexyl]-2,6-dimethylphenol |
| SMILES | CCCCCC(c1cc(C)c(O)c(C)c1)(c1cc(C)c(O)c(C)c1)c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C30H38O3/c1-8-9-10-11-30(24-12-18(2)27(31)19(3)13-24,25-14-20(4)28(32)21(5)15-25)26-16-22(6)29(33)23(7)17-26/h12-17,31-33H,8-11H2,1-7H3 |
| InChIKey | KGMFOTLZLOTNEP-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|