C28H38O2 — CID 58598379
4-[3-[4-(3-hydroxy-3-propylhex-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylphenol (PubChem CID 58598379) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is 4-[3-[4-(3-hydroxy-3-propylhex-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylphenol.
| Compound Name | 4-[3-[4-(3-hydroxy-3-propylhex-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylphenol |
|---|---|
| PubChem CID | 58598379 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 4-[3-[4-(3-hydroxy-3-propylhex-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylphenol |
| SMILES | CCCC(O)(C#Cc1ccc(C(CC)(CC)c2ccc(O)c(C)c2)cc1C)CCC |
| InChI | InChI=1S/C28H38O2/c1-7-16-27(30,17-8-2)18-15-23-11-12-24(19-21(23)5)28(9-3,10-4)25-13-14-26(29)22(6)20-25/h11-14,19-20,29-30H,7-10,16-17H2,1-6H3 |
| InChIKey | UVYIEYXAKLTIBO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|