C29H37NO4 — CID 11408642
2-[[4-[3-[4-(3-ethyl-3-hydroxypent-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylbenzoyl]amino]acetic acid (PubChem CID 11408642) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is 2-[[4-[3-[4-(3-ethyl-3-hydroxypent-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylbenzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[3-[4-(3-ethyl-3-hydroxypent-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylbenzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 11408642 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 2-[[4-[3-[4-(3-ethyl-3-hydroxypent-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylbenzoyl]amino]acetic acid |
| SMILES | CCC(O)(C#Cc1ccc(C(CC)(CC)c2ccc(C(=O)NCC(=O)O)c(C)c2)cc1C)CC |
| InChI | InChI=1S/C29H37NO4/c1-7-28(34,8-2)16-15-22-11-12-23(17-20(22)5)29(9-3,10-4)24-13-14-25(21(6)18-24)27(33)30-19-26(31)32/h11-14,17-18,34H,7-10,19H2,1-6H3,(H,30,33)(H,31,32) |
| InChIKey | XCVYWNYEDYXXMO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|