C39H47NO4 — CID 58598428
2-[5-[4-[3-[4-(3-ethyl-3-hydroxypent-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]pentyl]isoindole-1,3-dione (PubChem CID 58598428) has the molecular formula C39H47NO4 and a molecular weight of 593.81 g/mol. Its IUPAC name is 2-[5-[4-[3-[4-(3-ethyl-3-hydroxypent-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[4-[3-[4-(3-ethyl-3-hydroxypent-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58598428 |
| Molecular Formula | C39H47NO4 |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | 2-[5-[4-[3-[4-(3-ethyl-3-hydroxypent-1-ynyl)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]pentyl]isoindole-1,3-dione |
| SMILES | CCC(O)(C#Cc1ccc(C(CC)(CC)c2ccc(OCCCCCN3C(=O)c4ccccc4C3=O)c(C)c2)cc1C)CC |
| InChI | InChI=1S/C39H47NO4/c1-7-38(43,8-2)23-22-30-18-19-31(26-28(30)5)39(9-3,10-4)32-20-21-35(29(6)27-32)44-25-15-11-14-24-40-36(41)33-16-12-13-17-34(33)37(40)42/h12-13,16-21,26-27,43H,7-11,14-15,24-25H2,1-6H3 |
| InChIKey | CWZHWQNOSMXVJH-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|