C20H19NO6 — CID 71561776
3-[4-(1,3-dioxoisoindol-2-yl)butoxy]-4-methoxybenzoic acid (PubChem CID 71561776) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 3-[4-(1,3-dioxoisoindol-2-yl)butoxy]-4-methoxybenzoic acid.
| Compound Name | 3-[4-(1,3-dioxoisoindol-2-yl)butoxy]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 71561776 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-[4-(1,3-dioxoisoindol-2-yl)butoxy]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1OCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H19NO6/c1-26-16-9-8-13(20(24)25)12-17(16)27-11-5-4-10-21-18(22)14-6-2-3-7-15(14)19(21)23/h2-3,6-9,12H,4-5,10-11H2,1H3,(H,24,25) |
| InChIKey | UVSDJAMBSKPBJH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|