C22H20N2O5 — CID 22936492
2-[3-(6,7-dimethoxyquinolin-4-yl)oxypropyl]isoindole-1,3-dione (PubChem CID 22936492) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[3-(6,7-dimethoxyquinolin-4-yl)oxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(6,7-dimethoxyquinolin-4-yl)oxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22936492 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[3-(6,7-dimethoxyquinolin-4-yl)oxypropyl]isoindole-1,3-dione |
| SMILES | COc1cc2nccc(OCCCN3C(=O)c4ccccc4C3=O)c2cc1OC |
| InChI | InChI=1S/C22H20N2O5/c1-27-19-12-16-17(13-20(19)28-2)23-9-8-18(16)29-11-5-10-24-21(25)14-6-3-4-7-15(14)22(24)26/h3-4,6-9,12-13H,5,10-11H2,1-2H3 |
| InChIKey | IRZORBQJFUMEHC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|