C22H21N3O4S — CID 175452423
2-[4-(6,7-dimethoxyquinazolin-4-yl)-4-sulfanylbutyl]isoindole-1,3-dione (PubChem CID 175452423) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-[4-(6,7-dimethoxyquinazolin-4-yl)-4-sulfanylbutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)-4-sulfanylbutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175452423 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)-4-sulfanylbutyl]isoindole-1,3-dione |
| SMILES | COc1cc2ncnc(C(S)CCCN3C(=O)c4ccccc4C3=O)c2cc1OC |
| InChI | InChI=1S/C22H21N3O4S/c1-28-17-10-15-16(11-18(17)29-2)23-12-24-20(15)19(30)8-5-9-25-21(26)13-6-3-4-7-14(13)22(25)27/h3-4,6-7,10-12,19,30H,5,8-9H2,1-2H3 |
| InChIKey | YCDSGHTWJDYZHV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|