C36H32Br2N2O8 — CID 162236502
2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]isoindole-1,3-dione (PubChem CID 162236502) has the molecular formula C36H32Br2N2O8 and a molecular weight of 780.47 g/mol. Its IUPAC name is 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162236502 |
| Molecular Formula | C36H32Br2N2O8 |
| Molecular Weight | 780.47 g/mol |
| Exact Mass | 778.05 |
| IUPAC Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]isoindole-1,3-dione |
| SMILES | COc1cc(Br)c(CCN2C(=O)c3ccccc3C2=O)cc1OC.COc1cc(Br)c(CCN2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/2C18H16BrNO4/c2*1-23-15-9-11(14(19)10-16(15)24-2)7-8-20-17(21)12-5-3-4-6-13(12)18(20)22/h2*3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | ZWDAENQAKBTXQX-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|