C27H22BrNO5 — CID 11249404
2-[2-(10-bromo-2,3,4-trimethoxyphenanthren-1-yl)ethyl]isoindole-1,3-dione (PubChem CID 11249404) has the molecular formula C27H22BrNO5 and a molecular weight of 520.38 g/mol. Its IUPAC name is 2-[2-(10-bromo-2,3,4-trimethoxyphenanthren-1-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(10-bromo-2,3,4-trimethoxyphenanthren-1-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11249404 |
| Molecular Formula | C27H22BrNO5 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 2-[2-(10-bromo-2,3,4-trimethoxyphenanthren-1-yl)ethyl]isoindole-1,3-dione |
| SMILES | COc1c(OC)c(OC)c2c(c(Br)cc3ccccc32)c1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H22BrNO5/c1-32-23-19(12-13-29-26(30)17-10-6-7-11-18(17)27(29)31)21-20(28)14-15-8-4-5-9-16(15)22(21)24(33-2)25(23)34-3/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | PFQQDOBFENSWLW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|