C20H20BrNO3S2 — CID 126155862
(5S)-5-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126155862) has the molecular formula C20H20BrNO3S2 and a molecular weight of 466.42 g/mol. Its IUPAC name is (5S)-5-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5S)-5-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126155862 |
| Molecular Formula | C20H20BrNO3S2 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | (5S)-5-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(Br)c(C[C@@H]2SC(=S)N(CCc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C20H20BrNO3S2/c1-24-16-10-14(15(21)12-17(16)25-2)11-18-19(23)22(20(26)27-18)9-8-13-6-4-3-5-7-13/h3-7,10,12,18H,8-9,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | KMVFSDJEZHDNAP-SFHVURJKSA-N |
| XLogP | 4.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|