C18H15BrClNO4S — CID 126149833
(5R)-5-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-chlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126149833) has the molecular formula C18H15BrClNO4S and a molecular weight of 456.75 g/mol. Its IUPAC name is (5R)-5-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-chlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-5-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-chlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126149833 |
| Molecular Formula | C18H15BrClNO4S |
| Molecular Weight | 456.75 g/mol |
| Exact Mass | 454.96 |
| IUPAC Name | (5R)-5-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(Br)c(C[C@H]2SC(=O)N(c3ccccc3Cl)C2=O)cc1OC |
| InChI | InChI=1S/C18H15BrClNO4S/c1-24-14-7-10(11(19)9-15(14)25-2)8-16-17(22)21(18(23)26-16)13-6-4-3-5-12(13)20/h3-7,9,16H,8H2,1-2H3/t16-/m1/s1 |
| InChIKey | FQKXPKDEIDHFRT-MRXNPFEDSA-N |
| XLogP | 4.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.75 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|