C20H15BrClNO4S — CID 126146037
(5S)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126146037) has the molecular formula C20H15BrClNO4S and a molecular weight of 480.77 g/mol. Its IUPAC name is (5S)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126146037 |
| Molecular Formula | C20H15BrClNO4S |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 478.96 |
| IUPAC Name | (5S)-5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCOc1c(Br)cc(C[C@@H]2SC(=O)N(c3ccc(Cl)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C20H15BrClNO4S/c1-3-8-27-18-15(21)9-12(10-16(18)26-2)11-17-19(24)23(20(25)28-17)14-6-4-13(22)5-7-14/h1,4-7,9-10,17H,8,11H2,2H3/t17-/m0/s1 |
| InChIKey | DTCPYEHNWQPESP-KRWDZBQOSA-N |
| XLogP | 4.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|