C20H19BrFNO4S — CID 126146865
(5R)-5-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-ethyl-1,3-thiazolidine-2,4-dione (PubChem CID 126146865) has the molecular formula C20H19BrFNO4S and a molecular weight of 468.34 g/mol. Its IUPAC name is (5R)-5-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-ethyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-5-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-ethyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126146865 |
| Molecular Formula | C20H19BrFNO4S |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | (5R)-5-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-ethyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1C(=O)S[C@H](Cc2cc(Br)c(OCc3ccccc3F)c(OC)c2)C1=O |
| InChI | InChI=1S/C20H19BrFNO4S/c1-3-23-19(24)17(28-20(23)25)10-12-8-14(21)18(16(9-12)26-2)27-11-13-6-4-5-7-15(13)22/h4-9,17H,3,10-11H2,1-2H3/t17-/m1/s1 |
| InChIKey | JLIJQUVCKLEVRK-QGZVFWFLSA-N |
| XLogP | 4.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|