C25H28FNO3S2 — CID 126168926
(5R)-3-(2-cyclopentylethyl)-5-[[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126168926) has the molecular formula C25H28FNO3S2 and a molecular weight of 473.64 g/mol. Its IUPAC name is (5R)-3-(2-cyclopentylethyl)-5-[[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5R)-3-(2-cyclopentylethyl)-5-[[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126168926 |
| Molecular Formula | C25H28FNO3S2 |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | (5R)-3-(2-cyclopentylethyl)-5-[[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C[C@H]2SC(=S)N(CCC3CCCC3)C2=O)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C25H28FNO3S2/c1-29-22-14-18(10-11-21(22)30-16-19-8-4-5-9-20(19)26)15-23-24(28)27(25(31)32-23)13-12-17-6-2-3-7-17/h4-5,8-11,14,17,23H,2-3,6-7,12-13,15-16H2,1H3/t23-/m1/s1 |
| InChIKey | YDQLDRYFMDSZMQ-HSZRJFAPSA-N |
| XLogP | 5.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|