C27H19BrClNO3S — CID 126147705
(5S)-5-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methyl]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126147705) has the molecular formula C27H19BrClNO3S and a molecular weight of 552.88 g/mol. Its IUPAC name is (5S)-5-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methyl]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-5-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methyl]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126147705 |
| Molecular Formula | C27H19BrClNO3S |
| Molecular Weight | 552.88 g/mol |
| Exact Mass | 551.00 |
| IUPAC Name | (5S)-5-[[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methyl]-3-(4-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S[C@@H](Cc2ccc(OCc3cccc4ccccc34)c(Br)c2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H19BrClNO3S/c28-23-14-17(15-25-26(31)30(27(32)34-25)21-11-9-20(29)10-12-21)8-13-24(23)33-16-19-6-3-5-18-4-1-2-7-22(18)19/h1-14,25H,15-16H2/t25-/m0/s1 |
| InChIKey | JQHFDBUEKWWTFJ-VWLOTQADSA-N |
| XLogP | 7.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.88 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|