C17H11BrClNO4S — CID 126059386
(5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(2-chlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126059386) has the molecular formula C17H11BrClNO4S and a molecular weight of 440.70 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(2-chlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(2-chlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126059386 |
| Molecular Formula | C17H11BrClNO4S |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 438.93 |
| IUPAC Name | (5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(2-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\SC(=O)N(c3ccccc3Cl)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C17H11BrClNO4S/c1-24-14-6-9(10(18)8-13(14)21)7-15-16(22)20(17(23)25-15)12-5-3-2-4-11(12)19/h2-8,21H,1H3/b15-7- |
| InChIKey | FURVSLNVQRAZSO-CHHVJCJISA-N |
| XLogP | 5.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|