C14H12BrNO6S — CID 7279364
methyl 2-[(5E)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 7279364) has the molecular formula C14H12BrNO6S and a molecular weight of 402.22 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 7279364 |
| Molecular Formula | C14H12BrNO6S |
| Molecular Weight | 402.22 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | methyl 2-[(5E)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)S/C(=C/c2cc(OC)c(O)cc2Br)C1=O |
| InChI | InChI=1S/C14H12BrNO6S/c1-21-10-3-7(8(15)5-9(10)17)4-11-13(19)16(14(20)23-11)6-12(18)22-2/h3-5,17H,6H2,1-2H3/b11-4+ |
| InChIKey | PMYMKMGBOVIZNX-NYYWCZLTSA-N |
| XLogP | 2.37 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|