C23H22BrN3O5S — CID 126027543
(5E)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126027543) has the molecular formula C23H22BrN3O5S and a molecular weight of 532.42 g/mol. Its IUPAC name is (5E)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126027543 |
| Molecular Formula | C23H22BrN3O5S |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | (5E)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)N3CCN(c4ccccc4)CC3)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C23H22BrN3O5S/c1-32-19-11-15(17(24)13-18(19)28)12-20-22(30)27(23(31)33-20)14-21(29)26-9-7-25(8-10-26)16-5-3-2-4-6-16/h2-6,11-13,28H,7-10,14H2,1H3/b20-12+ |
| InChIKey | WGEJGDOECMSAEV-UDWIEESQSA-N |
| XLogP | 3.55 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|