C33H37N3O4S — CID 126278053
(5E)-5-[[5-(1-adamantyl)-2-methoxyphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126278053) has the molecular formula C33H37N3O4S and a molecular weight of 571.74 g/mol. Its IUPAC name is (5E)-5-[[5-(1-adamantyl)-2-methoxyphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(1-adamantyl)-2-methoxyphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126278053 |
| Molecular Formula | C33H37N3O4S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | (5E)-5-[[5-(1-adamantyl)-2-methoxyphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1/C=C1/SC(=O)N(CC(=O)N2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C33H37N3O4S/c1-40-28-8-7-26(33-18-22-13-23(19-33)15-24(14-22)20-33)16-25(28)17-29-31(38)36(32(39)41-29)21-30(37)35-11-9-34(10-12-35)27-5-3-2-4-6-27/h2-8,16-17,22-24H,9-15,18-21H2,1H3/b29-17+ |
| InChIKey | DSWDYEFIMJDHRJ-STBIYBPSSA-N |
| XLogP | 5.55 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|