C21H22BrNO3S2 — CID 126150747
(5S)-5-[(5-bromo-2,4-dimethoxyphenyl)methyl]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126150747) has the molecular formula C21H22BrNO3S2 and a molecular weight of 480.45 g/mol. Its IUPAC name is (5S)-5-[(5-bromo-2,4-dimethoxyphenyl)methyl]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5S)-5-[(5-bromo-2,4-dimethoxyphenyl)methyl]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126150747 |
| Molecular Formula | C21H22BrNO3S2 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | (5S)-5-[(5-bromo-2,4-dimethoxyphenyl)methyl]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(OC)c(C[C@@H]2SC(=S)N(CCCc3ccccc3)C2=O)cc1Br |
| InChI | InChI=1S/C21H22BrNO3S2/c1-25-17-13-18(26-2)16(22)11-15(17)12-19-20(24)23(21(27)28-19)10-6-9-14-7-4-3-5-8-14/h3-5,7-8,11,13,19H,6,9-10,12H2,1-2H3/t19-/m0/s1 |
| InChIKey | KHMQDDQGUSCEAN-IBGZPJMESA-N |
| XLogP | 4.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|