C26H27NO3S2 — CID 126153184
(5S)-5-[(2,7-diethoxynaphthalen-1-yl)methyl]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126153184) has the molecular formula C26H27NO3S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is (5S)-5-[(2,7-diethoxynaphthalen-1-yl)methyl]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5S)-5-[(2,7-diethoxynaphthalen-1-yl)methyl]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126153184 |
| Molecular Formula | C26H27NO3S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (5S)-5-[(2,7-diethoxynaphthalen-1-yl)methyl]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc2ccc(OCC)c(C[C@@H]3SC(=S)N(CCc4ccccc4)C3=O)c2c1 |
| InChI | InChI=1S/C26H27NO3S2/c1-3-29-20-12-10-19-11-13-23(30-4-2)22(21(19)16-20)17-24-25(28)27(26(31)32-24)15-14-18-8-6-5-7-9-18/h5-13,16,24H,3-4,14-15,17H2,1-2H3/t24-/m0/s1 |
| InChIKey | VLOBCABLBKDTMM-DEOSSOPVSA-N |
| XLogP | 5.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|