C26H27NO4S2 — CID 126168674
(5R)-5-[(2,7-diethoxynaphthalen-1-yl)methyl]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126168674) has the molecular formula C26H27NO4S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is (5R)-5-[(2,7-diethoxynaphthalen-1-yl)methyl]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5R)-5-[(2,7-diethoxynaphthalen-1-yl)methyl]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126168674 |
| Molecular Formula | C26H27NO4S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (5R)-5-[(2,7-diethoxynaphthalen-1-yl)methyl]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc2ccc(OCC)c(C[C@H]3SC(=S)N(Cc4ccc(OC)cc4)C3=O)c2c1 |
| InChI | InChI=1S/C26H27NO4S2/c1-4-30-20-12-8-18-9-13-23(31-5-2)22(21(18)14-20)15-24-25(28)27(26(32)33-24)16-17-6-10-19(29-3)11-7-17/h6-14,24H,4-5,15-16H2,1-3H3/t24-/m1/s1 |
| InChIKey | VBSQOGLSRRBWBT-XMMPIXPASA-N |
| XLogP | 5.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|