C20H18N2O4 — CID 102299709
2-[2-(6,7-dimethoxy-1H-indol-3-yl)ethyl]isoindole-1,3-dione (PubChem CID 102299709) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[2-(6,7-dimethoxy-1H-indol-3-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(6,7-dimethoxy-1H-indol-3-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102299709 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-[2-(6,7-dimethoxy-1H-indol-3-yl)ethyl]isoindole-1,3-dione |
| SMILES | COc1ccc2c(CCN3C(=O)c4ccccc4C3=O)c[nH]c2c1OC |
| InChI | InChI=1S/C20H18N2O4/c1-25-16-8-7-13-12(11-21-17(13)18(16)26-2)9-10-22-19(23)14-5-3-4-6-15(14)20(22)24/h3-8,11,21H,9-10H2,1-2H3 |
| InChIKey | QMXFTWPQHVIQQR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|