C24H24N2O2 — CID 10499546
2-[2-(5-cyclohexyl-1H-indol-3-yl)ethyl]isoindole-1,3-dione (PubChem CID 10499546) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[2-(5-cyclohexyl-1H-indol-3-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(5-cyclohexyl-1H-indol-3-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10499546 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[2-(5-cyclohexyl-1H-indol-3-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1c[nH]c2ccc(C3CCCCC3)cc12 |
| InChI | InChI=1S/C24H24N2O2/c27-23-19-8-4-5-9-20(19)24(28)26(23)13-12-18-15-25-22-11-10-17(14-21(18)22)16-6-2-1-3-7-16/h4-5,8-11,14-16,25H,1-3,6-7,12-13H2 |
| InChIKey | KODHCXJFKAMAOR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|