C25H17N3O6 — CID 57206075
(4-nitrophenyl) 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1H-indole-5-carboxylate (PubChem CID 57206075) has the molecular formula C25H17N3O6 and a molecular weight of 455.43 g/mol. Its IUPAC name is (4-nitrophenyl) 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1H-indole-5-carboxylate.
| Compound Name | (4-nitrophenyl) 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 57206075 |
| Molecular Formula | C25H17N3O6 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (4-nitrophenyl) 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1H-indole-5-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1ccc2[nH]cc(CCN3C(=O)c4ccccc4C3=O)c2c1 |
| InChI | InChI=1S/C25H17N3O6/c29-23-19-3-1-2-4-20(19)24(30)27(23)12-11-16-14-26-22-10-5-15(13-21(16)22)25(31)34-18-8-6-17(7-9-18)28(32)33/h1-10,13-14,26H,11-12H2 |
| InChIKey | CMQIOOSMPBAQSQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|