C12H14N4O2 — CID 10562361
3-(2-azidoethyl)-6,7-dimethoxy-1H-indole (PubChem CID 10562361) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-(2-azidoethyl)-6,7-dimethoxy-1H-indole.
| Compound Name | 3-(2-azidoethyl)-6,7-dimethoxy-1H-indole |
|---|---|
| PubChem CID | 10562361 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-(2-azidoethyl)-6,7-dimethoxy-1H-indole |
| SMILES | COc1ccc2c(CCN=[N+]=[N-])c[nH]c2c1OC |
| InChI | InChI=1S/C12H14N4O2/c1-17-10-4-3-9-8(5-6-15-16-13)7-14-11(9)12(10)18-2/h3-4,7,14H,5-6H2,1-2H3 |
| InChIKey | BNZZEHPKTRRHSW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|