C20H22N2O4 — CID 9234059
2-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]isoindole-1,3-dione (PubChem CID 9234059) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9234059 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]isoindole-1,3-dione |
| SMILES | COc1cc(C)c(CN(C)CN2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C20H22N2O4/c1-13-9-17(25-3)18(26-4)10-14(13)11-21(2)12-22-19(23)15-7-5-6-8-16(15)20(22)24/h5-10H,11-12H2,1-4H3 |
| InChIKey | ASQGQPXLEBKATG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|