C21H24N2O4 — CID 42944047
2-[2-hydroxy-3-[(2-methoxy-5-methylphenyl)methyl-methylamino]propyl]isoindole-1,3-dione (PubChem CID 42944047) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-[2-hydroxy-3-[(2-methoxy-5-methylphenyl)methyl-methylamino]propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-hydroxy-3-[(2-methoxy-5-methylphenyl)methyl-methylamino]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42944047 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-[2-hydroxy-3-[(2-methoxy-5-methylphenyl)methyl-methylamino]propyl]isoindole-1,3-dione |
| SMILES | COc1ccc(C)cc1CN(C)CC(O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H24N2O4/c1-14-8-9-19(27-3)15(10-14)11-22(2)12-16(24)13-23-20(25)17-6-4-5-7-18(17)21(23)26/h4-10,16,24H,11-13H2,1-3H3 |
| InChIKey | CETPYVIIBOMENH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|