C21H24N2O4 — CID 9234389
1-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-5-methylindole-2,3-dione (PubChem CID 9234389) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-5-methylindole-2,3-dione.
| Compound Name | 1-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-5-methylindole-2,3-dione |
|---|---|
| PubChem CID | 9234389 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-5-methylindole-2,3-dione |
| SMILES | COc1cc(C)c(CN(C)CN2C(=O)C(=O)c3cc(C)ccc32)cc1OC |
| InChI | InChI=1S/C21H24N2O4/c1-13-6-7-17-16(8-13)20(24)21(25)23(17)12-22(3)11-15-10-19(27-5)18(26-4)9-14(15)2/h6-10H,11-12H2,1-5H3 |
| InChIKey | ABPWHNWDVDRVBF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|