C23H29N2O4+ — CID 9234155
(4,5-dimethoxy-2-methylphenyl)methyl-[(2,3-dioxo-5-propan-2-ylindol-1-yl)methyl]-methylazanium (PubChem CID 9234155) has the molecular formula C23H29N2O4+ and a molecular weight of 397.50 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl-[(2,3-dioxo-5-propan-2-ylindol-1-yl)methyl]-methylazanium.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(2,3-dioxo-5-propan-2-ylindol-1-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9234155 |
| Molecular Formula | C23H29N2O4+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(2,3-dioxo-5-propan-2-ylindol-1-yl)methyl]-methylazanium |
| SMILES | COc1cc(C)c(C[NH+](C)CN2C(=O)C(=O)c3cc(C(C)C)ccc32)cc1OC |
| InChI | InChI=1S/C23H28N2O4/c1-14(2)16-7-8-19-18(10-16)22(26)23(27)25(19)13-24(4)12-17-11-21(29-6)20(28-5)9-15(17)3/h7-11,14H,12-13H2,1-6H3/p+1 |
| InChIKey | SZLVQJVKBKVWSH-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|