C25H33Cl2N3O3 — CID 23363923
1-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]-5-propan-2-ylindole-2,3-dione;dihydrochloride (PubChem CID 23363923) has the molecular formula C25H33Cl2N3O3 and a molecular weight of 494.46 g/mol. Its IUPAC name is 1-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]-5-propan-2-ylindole-2,3-dione;dihydrochloride.
| Compound Name | 1-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]-5-propan-2-ylindole-2,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 23363923 |
| Molecular Formula | C25H33Cl2N3O3 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 1-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]-5-propan-2-ylindole-2,3-dione;dihydrochloride |
| SMILES | COc1ccccc1CN1CCN(CCN2C(=O)C(=O)c3cc(C(C)C)ccc32)CC1.Cl.Cl |
| InChI | InChI=1S/C25H31N3O3.2ClH/c1-18(2)19-8-9-22-21(16-19)24(29)25(30)28(22)15-14-26-10-12-27(13-11-26)17-20-6-4-5-7-23(20)31-3;;/h4-9,16,18H,10-15,17H2,1-3H3;2*1H |
| InChIKey | VEDASJBHOZSAPD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|