C16H12BrNO3 — CID 60711521
6-bromo-1-[(2-methoxyphenyl)methyl]indole-2,3-dione (PubChem CID 60711521) has the molecular formula C16H12BrNO3 and a molecular weight of 346.18 g/mol. Its IUPAC name is 6-bromo-1-[(2-methoxyphenyl)methyl]indole-2,3-dione.
| Compound Name | 6-bromo-1-[(2-methoxyphenyl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 60711521 |
| Molecular Formula | C16H12BrNO3 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 6-bromo-1-[(2-methoxyphenyl)methyl]indole-2,3-dione |
| SMILES | COc1ccccc1CN1C(=O)C(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C16H12BrNO3/c1-21-14-5-3-2-4-10(14)9-18-13-8-11(17)6-7-12(13)15(19)16(18)20/h2-8H,9H2,1H3 |
| InChIKey | QXDZZZXXSHATHO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|