C23H20BrNO2 — CID 139259304
1-benzyl-6-bromo-3-[(2-methoxyphenyl)methyl]-3H-indol-2-one (PubChem CID 139259304) has the molecular formula C23H20BrNO2 and a molecular weight of 422.32 g/mol. Its IUPAC name is 1-benzyl-6-bromo-3-[(2-methoxyphenyl)methyl]-3H-indol-2-one.
| Compound Name | 1-benzyl-6-bromo-3-[(2-methoxyphenyl)methyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 139259304 |
| Molecular Formula | C23H20BrNO2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 1-benzyl-6-bromo-3-[(2-methoxyphenyl)methyl]-3H-indol-2-one |
| SMILES | COc1ccccc1CC1C(=O)N(Cc2ccccc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C23H20BrNO2/c1-27-22-10-6-5-9-17(22)13-20-19-12-11-18(24)14-21(19)25(23(20)26)15-16-7-3-2-4-8-16/h2-12,14,20H,13,15H2,1H3 |
| InChIKey | YZUDRBJLHPNHRM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |