C19H20BrNO3 — CID 26367906
(3R)-5-bromo-3-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3H-indol-2-one (PubChem CID 26367906) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is (3R)-5-bromo-3-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3H-indol-2-one.
| Compound Name | (3R)-5-bromo-3-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3H-indol-2-one |
|---|---|
| PubChem CID | 26367906 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (3R)-5-bromo-3-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3H-indol-2-one |
| SMILES | CCN1C(=O)[C@H](Cc2ccc(OC)cc2OC)c2cc(Br)ccc21 |
| InChI | InChI=1S/C19H20BrNO3/c1-4-21-17-8-6-13(20)10-15(17)16(19(21)22)9-12-5-7-14(23-2)11-18(12)24-3/h5-8,10-11,16H,4,9H2,1-3H3/t16-/m1/s1 |
| InChIKey | RCKXRDPWQCKFGT-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |